On Target NK2R_HUMAN 0.46153846/CHEMBL1683150
For the given ligand MITRAGYNINE, we have found in our database that, being scored 0.46153846, the most similar ligand is CHEMBL1683150. Check out the elaboration below.
| MITRAGYNINE (Given Ligand) | CHEMBL1683150 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CCCCc1ccc(nc1)C(=O)NC2(CCCC2)C(=O)N[C@@H](Cc3ccccc3)C(=O)NCC4CCN(CC5CCOCC5)CC4 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 00018002 01007a00 00104102 54810f10 841c1120 00100000 00002000 2200300d 00600980 000908d0 08390004 5003b800 8600880a 08302801 80020400 020c110c 00000000 02000006 00602408 00000201 44000120 38278610 21802003 8350001c 00140c00 c0000000 08000240 90000000 0c400304 0106000b a0044000 00006e00 |