On Target CNR1_HUMAN 0.5719844/CHEMBL445022
For the given ligand MITRAGYNINE, we have found in our database that, being scored 0.5719844, the most similar ligand is CHEMBL445022. Check out the elaboration below.
| MITRAGYNINE (Given Ligand) | CHEMBL445022 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CC[C@H]1C[C@@H]2CN3CCC4C(Nc5cc([C@H]6C[C@H]7C(C/C/7=C/C)[C@@H](C(Cc8c6[nH]c9ccccc89)NC)C(=O)OC)c(OC)cc45)[C@](C2)([C@H]13)C(=O)OC |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0801400a 43004e08 6010010a 71810710 200c1120 c0082042 03002400 21001609 00700900 001989f8 08308004 50839840 1c02883a 21e08810 01021561 020c208e 00a68201 06000005 0af92418 80020201 64100100 18208a38 2180c088 93500411 00043001 e0002001 08444000 d0001080 06488386 0086401a 26060280 20402620 |