On Target ADRB1_HUMAN 0.44144145/CHEMBL463182
For the given ligand MITRAGYNINE, we have found in our database that, being scored 0.44144145, the most similar ligand is CHEMBL463182. Check out the elaboration below.
| MITRAGYNINE (Given Ligand) | CHEMBL463182 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | O[C@@H](CN[C@H]1CCc2ccc(Oc3cccc(c3)C(=O)O)cc2C1)c4ccc(Cl)nc4 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 00008002 4b004a08 2010410a 01010610 000410a0 c0004000 02042000 20000001 00400980 000908c0 08300004 40809800 030088a6 20200000 41084005 220c000c 10000200 02000004 00282400 00020201 40400100 18728b60 22804000 91400014 00044000 80000001 08160000 10204000 04400282 0006000a c0002400 00022600 |