On Target DRD5_HUMAN 0.50259066/CHEMBL201584
For the given ligand MITRAGYNINE, we have found in our database that, being scored 0.50259066, the most similar ligand is CHEMBL201584. Check out the elaboration below.
| MITRAGYNINE (Given Ligand) | CHEMBL201584 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CN1CCC(Cc2[nH]c3ccccc3c2CC1)c4ccccc4 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0200000a 01004a00 00100102 51010610 00041020 00000002 01002000 20000001 00500880 000908c0 08308004 40818000 10000802 00608000 00820060 02040004 00000200 06000004 00200408 00000201 40200100 18308008 20c04000 91500010 00042800 80000001 08000000 10000080 04000004 0086000a 00040200 20002720 |