On Target OPRX_HUMAN 0.64021164/CHEMBL3326229
For the given ligand MITRAGYNINE, we have found in our database that, being scored 0.64021164, the most similar ligand is CHEMBL3326229. Check out the elaboration below.
| MITRAGYNINE (Given Ligand) | CHEMBL3326229 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | Cl.CN(C)[C@@]1(CC[C@]2(CC1)N(C)CCc3c2[nH]c4ccccc34)c5ccccc5 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0000000a 0100c800 00100102 51010e10 00041020 00100002 01002000 22003001 00700880 000908c0 08318004 40838000 10000882 00608000 00020460 02040104 00000200 06000026 02202408 00000201 40320100 18218018 20804000 91500010 00142000 c0000001 08000000 90000080 04000106 00860002 00060200 20026620 |