On Target 5HT2C_HUMAN 0.5313808/CHEMBL553794
For the given ligand MITRAGYNINE, we have found in our database that, being scored 0.5313808, the most similar ligand is CHEMBL553794. Check out the elaboration below.
| MITRAGYNINE (Given Ligand) | CHEMBL553794 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CNC(=O)Cn1c2CN(CCCCC34CCCc5cccc(NC3=O)c45)CCc2c6ccccc16 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0001400a 01008800 40500102 51090e18 24045020 00106102 01002000 22003001 00600880 000908d0 08390024 4081b000 1500988a 00708800 40020d60 06040104 0004c200 c2800026 08202408 00020201 44120101 38218618 20806001 91500017 08152000 c0000301 08004010 90001080 0c448506 00060053 20162280 20006620 |