On Target ACM5_HUMAN 0.4125/CHEMBL3184335
For the given ligand suplatast, we have found in our database that, being scored 0.4125, the most similar ligand is CHEMBL3184335. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3184335 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | FC(F)(F)Oc1ccc2N(CCCOc3ccccc3)C(=O)C(=O)c2c1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 14004002 42001808 20100108 00010600 20011010 82010040 02000000 00080008 04800080 00080840 08280004 4041b000 03808022 20100000 c1024141 2008200a 00248000 02000000 08880000 00020200 40100400 18320600 21002088 8140001d 00000001 80000280 00040010 c0011080 06088200 00060003 80007000 20002640 |