On Target NPY2R_HUMAN 0.38607594/CHEMBL3104195
For the given ligand suplatast, we have found in our database that, being scored 0.38607594, the most similar ligand is CHEMBL3104195. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3104195 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CCOc1ccc(cc1)C(N2CCN(CC2)c3ccc(NC(=O)C(CC)CC)cc3F)C(=O)N(CC)CC |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04004002 01001008 20100328 06010600 20001100 00002010 02040000 02001000 04000080 00094ac0 08280004 6000b000 07818802 00103001 41020441 00080008 00040400 02000000 08000000 00020201 40100000 38248600 60002022 8340001a 00000000 c0000000 00320000 90000081 0c008300 00068003 00046000 00000600 |