On Target OPRM_HUMAN 0.36363637/CHEMBL1258503
For the given ligand suplatast, we have found in our database that, being scored 0.36363637, the most similar ligand is CHEMBL1258503. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL1258503 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | NC(=O)c1cccc(O[C@@H]2C[C@H]3CC[C@@H](C2)N3CC(=O)Nc4ccccc4)c1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04004002 45000808 20100128 04010700 00081000 02000010 02000000 20001000 00000000 00000ac0 00280004 5001a000 02808802 00902080 91004041 20082008 00a40000 02000000 08c82000 00020201 40100000 38028610 21002081 02508016 00000001 80000000 00000000 10001080 08008200 00060001 80064000 00002240 |