On Target CCR5_HUMAN 0.40689656/CHEMBL370552
For the given ligand suplatast, we have found in our database that, being scored 0.40689656, the most similar ligand is CHEMBL370552. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL370552 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CCN(C1CCN(CCC(c2ccccc2)c3ccc(NC(=O)C(C)(C)C)cc3)CC1)C(=O)Cc4ccc(cc4)S(=O)(=O)C |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00004002 01801e00 00120100 40910600 20000000 00000000 00000000 21000000 00000880 000809e0 08382004 70019000 01008002 00118000 c0220040 00040000 04040000 02000000 08000000 00002201 c0100100 182c0600 20802000 89500019 00000000 a0000000 00000000 500000a0 04008080 0006001b 00002000 00012620 |