On Target MC3R_HUMAN 0.3448276/CHEMBL467586
For the given ligand suplatast, we have found in our database that, being scored 0.3448276, the most similar ligand is CHEMBL467586. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL467586 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CNCC(=O)N[C@@H](C(C)C)c1cc(Cl)ccc1N2CCN(CC2)C(=O)[C@H](C)Cc3ccc(Cl)cc3OC |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0000c002 0c803208 20100128 04010600 00001000 00100040 96000000 22001208 00000800 20090ac8 08300004 4000b840 06008826 00002002 81020541 00042008 00248000 03000002 08000008 00820201 c0100100 38008700 20000021 0244041a 00002800 c0000000 000c0000 90001080 08088300 0006800b 00044080 62020600 |