On Target DRD2_HUMAN 0.41447368/CHEMBL2165124
For the given ligand suplatast, we have found in our database that, being scored 0.41447368, the most similar ligand is CHEMBL2165124. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL2165124 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CCOc1ccc(cc1)N2CCN(CCCCOc3ccc4CCC(=O)Nc4c3)CC2 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04004002 80000208 20100128 04010700 30101000 06002040 02040000 20000008 00000800 00080ac0 08380024 40009000 04808022 08102000 11020041 000c2008 00048080 02000000 08400008 00022601 40100100 38000600 21002021 02400012 00000800 81000000 00160210 10001080 08008200 0006000b 00000000 20020e00 |