On Target GRM7_HUMAN 0.4064171/CHEMBL3560393
For the given ligand suplatast, we have found in our database that, being scored 0.4064171, the most similar ligand is CHEMBL3560393. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3560393 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CC(=O)Nc1ccc(SCC(=O)c2cc(C)n(CC3COc4ccccc4O3)c2C)cc1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04004002 00803a08 20120108 5031061b 00015060 42008800 02002200 0000000c 00422100 018a48d0 00680004 60018000 0081c002 00348000 032210c1 0a0ce00c 04240400 82800004 08a00402 00020000 c4100000 18248610 27806001 0e50001d 00042000 40000000 08000200 148010d0 00008206 4006004b 90000200 010102e0 |