On Target AA1R_HUMAN 0.33043477/CHEMBL1760901
For the given ligand suplatast, we have found in our database that, being scored 0.33043477, the most similar ligand is CHEMBL1760901. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL1760901 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CCN(C(=O)C)c1ccc(OC)c2nc(NC(=O)N3CCC(CC3)S(=O)(=O)c4cccc(c4)C(F)(F)F)sc12 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00034082 15881208 601a0108 01910e40 000c1108 00818404 83008504 1002a118 04400200 0100d8d4 00782a24 f0158040 08019032 0b540002 832020cb 0034040c 04041400 02004080 08200012 00a22201 c0100100 5c050682 20806a20 0a750019 08012000 8c200300 40040080 b0000c84 00008218 080e2821 10180000 05414760 |