On Target CXCR3_HUMAN 0.37037036/CHEMBL3949577
For the given ligand suplatast, we have found in our database that, being scored 0.37037036, the most similar ligand is CHEMBL3949577. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3949577 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1cc(CN(C)C(C)c2ccc3OCCc3c2)ccc1NCCN4C(=O)CCC4=O |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04025002 44003808 20100128 84010600 80001041 02000010 12040000 22001248 00000000 00080ac0 08200004 40009000 04808802 0000a000 01040441 00086018 08042000 02000000 0c080400 00020201 40120000 38008600 21000001 0244801a 00000000 c0000000 28320000 90800084 08008302 00060003 00040800 00800600 |