On Target ACM1_HUMAN 0.37078652/CHEMBL2057512
For the given ligand suplatast, we have found in our database that, being scored 0.37078652, the most similar ligand is CHEMBL2057512. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL2057512 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | O=C(C1CN(C1)S(=O)(=O)c2ccc3OCCc3c2)N4CCN(CC4)c5ccncc5 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04001012 00806408 21106128 05b10600 000c1140 02010000 02008000 00000248 00800000 00480b60 08202014 6000d000 08808802 00002001 81a40081 000c211c 08046004 02000000 04600810 00027602 c0100000 38048600 21800021 1a40001a 02000000 8000000c 00808000 0000108c 08000700 20060013 00000000 00010662 |