On Target PTAFR_HUMAN 0.3125/CHEMBL54106
For the given ligand suplatast, we have found in our database that, being scored 0.3125, the most similar ligand is CHEMBL54106. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL54106 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccc(cc1)C(=C\C=C\C(=O)Nc2ccc(Cc3cccnc3)cc2)c4ccc(OC)cc4 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 08004202 0004c808 20004108 40010610 00041000 00000001 82042080 01000400 01400000 00080840 082c0004 60008008 00008802 20118000 01000043 0004000c 20050400 02000104 08290480 00020000 40100010 08008600 60802001 00400010 00040000 a0000000 08522000 40000080 00408280 080e0003 04000000 01000600 |