On Target ACM3_HUMAN 0.41353384/CHEMBL82859
For the given ligand suplatast, we have found in our database that, being scored 0.41353384, the most similar ligand is CHEMBL82859. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL82859 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccc(cc1)N(C2CCN(Cc3ccccc3)CC2)C(=O)c4ccccc4 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00004002 01001c08 20100108 00010600 20001000 00000000 02000000 22001008 00000000 000009e0 00280004 5001c000 00008822 00100000 01020441 00000008 00040000 02000000 08000000 00020201 60100000 180a8600 20012000 0050001c 00000000 c0000000 00040000 90000080 00008300 00060011 a0040000 00000200 |