On Target 5HT1E_HUMAN 0.28502417/CHEMBL29410
For the given ligand suplatast, we have found in our database that, being scored 0.28502417, the most similar ligand is CHEMBL29410. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL29410 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)cc1N4CCN5CCCCC5C4 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0001c012 11800008 21100b2a 04b90600 a0181000 00402010 06020000 20000008 00000040 00408ac0 04202204 70018880 0204160e 00022001 813a11c1 00024408 00042088 02002400 08c02000 00026201 c0100000 78000998 200400e1 0b50821a 00882080 a4102000 20040400 1001008c 08808604 20060000 00000c00 00c30660 |