On Target AGTR2_HUMAN 0.28042328/CHEMBL215160
For the given ligand suplatast, we have found in our database that, being scored 0.28042328, the most similar ligand is CHEMBL215160. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL215160 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CCCCOC(=O)NS(=O)(=O)c1ccc(OCCCC)cc1c2ccc(Cn3ccnc3)cc2 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04002012 40c04209 21000108 04b10700 00081040 02000020 02000000 80001000 00000108 000028c0 0000a009 60008000 8088980a 00010181 99300081 001c200c 020220c0 02000000 04480800 10027201 80000000 18008c00 31200040 89480018 0000a004 80000082 80880000 000000ce 04004600 2046004a 400c5000 00010660 |