On Target NPFF1_HUMAN 0.32704404/CHEMBL3361420
For the given ligand suplatast, we have found in our database that, being scored 0.32704404, the most similar ligand is CHEMBL3361420. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3361420 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1cccc(NC2(CNC(=O)CNC(=N)N)CCN(Cc3ccccc3)CC2)c1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00004002 81003408 20100128 04010e00 20001000 00000000 02000000 22003008 00200440 00000be2 00200004 5003a000 0400a802 08002000 01020441 00100008 00050090 02000000 08000000 00022601 60100000 38058600 20000003 0250001a 00000000 c0000000 40000000 90000080 08008310 00060011 20044000 00020200 |