On Target CXCR4_HUMAN 0.30569947/CHEMBL4100900
For the given ligand suplatast, we have found in our database that, being scored 0.30569947, the most similar ligand is CHEMBL4100900. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL4100900 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | Cc1cc(C(=O)NCc2ccc(CNS(=O)(=O)c3ccc4OCCc4c3)cc2)n(C)n1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04001014 00805008 21082108 01b10e00 01081140 02010002 16040001 02003649 00800900 001818c0 08312020 6010c000 80808802 00000001 81240481 080c211c 08002000 02900000 04400800 00226000 80000001 1801a600 01800800 0a40001c 02004010 c0000004 48a20000 8000108c 00000704 20060003 84048000 00010762 |