On Target CNR2_HUMAN 0.42142856/CHEMBL466402
For the given ligand suplatast, we have found in our database that, being scored 0.42142856, the most similar ligand is CHEMBL466402. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL466402 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CC(C)(C(=O)Nc1ccc(cc1)C(F)(F)F)S(=O)(=O)c2ccc(Cl)cc2 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0000c002 04800a00 20120100 00910601 20010000 88000000 00000400 00000000 00020000 02004c50 00682004 60009800 02008006 01148000 80220040 00000000 04040000 02000000 08000000 00022001 c0100000 1a000700 20802000 08480019 00002000 80000000 10004200 900000c0 00008000 00060041 10100000 02030220 |