On Target 5HT6R_HUMAN 0.40384614/CHEMBL3409260
For the given ligand suplatast, we have found in our database that, being scored 0.40384614, the most similar ligand is CHEMBL3409260. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3409260 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | O=S(=O)(c1ccccc1)n2ccc3c(cccc23)N4CCN(CCCOc5ccccc5)CC4 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04004052 00800008 21102128 04b10640 00041000 02000000 42008000 20000800 00000000 00000a40 10202004 60008000 00801802 00442001 85200041 000c200c 00240000 00000108 08e00000 00022204 c0100000 38048008 218000f1 8a40001a 00800001 80000000 20008080 00000088 0800c200 20060020 00040200 00010260 |