On Target 5HT2C_HUMAN 0.38410595/CHEMBL1642865
For the given ligand suplatast, we have found in our database that, being scored 0.38410595, the most similar ligand is CHEMBL1642865. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL1642865 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | Cl.NCCC(=O)Nc1ccc2[nH]nc(c2c1)S(=O)(=O)c3cccc4ccccc34 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00004082 00802308 20120020 00900600 20040000 00000000 02020000 00000008 00000000 00000940 00282004 70009000 18008002 00500000 80220040 0004000c 04041008 00000008 08600410 00226484 f0100800 1c201608 20802800 18200019 00100000 08000000 00000000 048000c0 00008200 00060011 08000000 00034264 |