On Target 5HT2B_HUMAN 0.39041096/CHEMBL209324
For the given ligand suplatast, we have found in our database that, being scored 0.39041096, the most similar ligand is CHEMBL209324. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL209324 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccccc1N2CCN(CCCCNS(=O)(=O)c3ccc(C)cc3)CC2 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00004012 02801008 21100128 05b10600 80081008 00000000 02000000 20000000 00200000 00400ac0 00202004 60028000 00000002 00002001 81600041 00004008 00042000 02000000 08400000 00026601 c0100000 38000000 20000021 1a40801a 02000000 80000004 20000000 100000ac 08008600 20060000 00000800 00010270 |