On Target BKRB2_HUMAN 0.34101382/CHEMBL280869
For the given ligand suplatast, we have found in our database that, being scored 0.34101382, the most similar ligand is CHEMBL280869. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL280869 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CN(C(=O)Cc1ccc(C(=O)c2ccc(cc2)S(=O)(=O)C)n1C)c3ccc(Cl)c(COc4cccc5ccc(C)nc45)c3Cl |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0400c00a 00805a08 60124128 50910600 24041020 04084024 02800000 09301000 00000100 00080ad0 0828a024 60859800 03808806 08510400 c1220441 020c008c 04249000 0a000005 08212000 80022000 c0101000 18268728 20802000 8bc5941d 00043400 e0082682 10080250 400010a0 044a8284 00060043 c0047200 22030620 |