On Target 5HT4R_HUMAN 0.34391534/CHEMBL180680
For the given ligand suplatast, we have found in our database that, being scored 0.34391534, the most similar ligand is CHEMBL180680. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL180680 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | Fc1ccc(cc1)N2CCN(CC2)S(=O)(=O)CCCN3CCC(CNC(=O)c4cccc5OCCOc45)CC3 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04004082 47001808 20100128 07310600 01001000 00020110 02020200 22001400 00202010 00100ac0 08202404 50038020 0080c802 00043081 81204441 2008a008 00040000 02008000 08280002 00224201 40100040 b8068602 24000220 2a54803e 0a000000 c0000000 00000800 9080008d 08008300 00068069 a4040000 01112260 |