On Target CCR2_HUMAN 0.37142858/CHEMBL246313
For the given ligand suplatast, we have found in our database that, being scored 0.37142858, the most similar ligand is CHEMBL246313. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL246313 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | C[N+](C)(Cc1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)cc1)C3CCSCC3 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0000c002 09000800 00100100 80110640 00000000 00000000 04000000 02001000 04000000 00084848 00280004 6006c800 02018846 00148000 80000440 00000000 04040000 02000000 08000000 00000201 40100000 18028700 20012300 00400014 00002000 c0100000 00040000 80000080 00008100 00060821 a0040000 01030200 |