On Target EDNRA_HUMAN 0.29333332/CHEMBL290026
For the given ligand Aspirin, we have found in our database that, being scored 0.29333332, the most similar ligand is CHEMBL290026. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL290026 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | COc1ccc([C@H]2c3ccccc3[C@@H](c3ccc(OC)cc3)[C@@H]2C(=O)O)cc1 |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 00000000 01000008 2000010a 00010200 00001000 00000002 03041400 01000001 00000800 00080840 08100000 40009000 04008002 00201000 01000001 000a0008 00000000 02000000 00500008 00020001 00000100 08000a00 01004040 00400010 00000800 a0000001 00120000 40000000 02000280 00020002 00000000 00000400 |