On Target ACM5_HUMAN 0.30379745/CHEMBL41
For the given ligand Aspirin, we have found in our database that, being scored 0.30379745, the most similar ligand is CHEMBL41. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL41 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | CNCCC(Oc1ccc(C(F)(F)F)cc1)c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 04000000 00000208 20100108 00010600 00001000 02004000 02040400 00000000 00000900 000808d0 08300000 40008000 00800002 01010000 01000001 020c2008 00200000 02000000 00800000 00020001 00000100 18000020 01000080 00c01010 00000000 80002000 00020400 90000000 00000200 0006000a 40100000 00000640 |