On Target ADRB2_HUMAN 0.4477612/CHEMBL1902287
For the given ligand Aspirin, we have found in our database that, being scored 0.4477612, the most similar ligand is CHEMBL1902287. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1902287 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | CC(Cc1ccc(O)cc1)NCC(O)c1ccc(O)c(O)c1.O=C(O)c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 00000000 4a000808 20100100 00010600 00000080 80004000 02000000 00000000 00000980 00080840 08300000 40008000 00008002 00000000 00080000 00088008 10000000 02000000 00000000 00020201 00000100 18220a20 02000000 81400014 00000000 80000000 00520000 00000000 04000000 00060002 c0000000 00002600 |