On Target HRH2_HUMAN 0.28/CHEMBL490632
For the given ligand Aspirin, we have found in our database that, being scored 0.28, the most similar ligand is CHEMBL490632. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL490632 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | COc1c(OCCF)cccc1C(=O)C1CCN(CCc2ccc(C)cc2)CC1 |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 06020000 43000808 2010010a 00210600 00001000 40020000 02000000 21000200 00100980 000808c0 08300000 50019840 0480c002 20200080 01004001 2208a008 00000000 02000000 00080400 00020201 00000100 18220200 00000000 81500414 00000000 c0000000 00000800 10000000 04000300 0006400a 80000000 00802600 |