On Target CCR5_HUMAN 0.29545453/CHEMBL319689
For the given ligand Aspirin, we have found in our database that, being scored 0.29545453, the most similar ligand is CHEMBL319689. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL319689 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | O=C(O)c1ccc(CCCC2(O)CCN(C[C@H]3CN(CC4CCCCC4)C[C@@H]3c3ccccc3)CC2)cc1 |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 00000000 01000e00 00100102 40050600 00080000 00004010 00000000 20000000 00200980 000809e0 08300000 50038800 00008002 00200000 00000000 000c0008 00000000 02000000 02c02000 00000201 00000100 18220a30 01000080 81500014 00000001 80000000 00000000 10000000 04000002 0006001a c0020000 00002600 |