On Target MC3R_HUMAN 0.2/CHEMBL392092
For the given ligand Aspirin, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL392092. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL392092 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | COc1ccc(C(=O)c2nc3ccc(C(=O)N(CCC(C)C)CCC(C)C)cc3n2CCCN2CCCCC2)cc1 |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 0000000a 01009c08 20100509 10050600 000c1060 00084000 02040000 22001004 00200100 100819c0 0928800c 50818000 00009802 01d48000 010204c1 020c008c 00100008 02800005 00600000 00020201 c0000000 18068630 21806001 0050041c 00004000 c0000000 00120044 90000000 00400304 00460813 e00c8000 200026a0 |