On Target CXCR3_HUMAN 0.26041666/CHEMBL1085258
For the given ligand Aspirin, we have found in our database that, being scored 0.26041666, the most similar ligand is CHEMBL1085258. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1085258 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | COc1ccc(S(=O)(=O)N(Cc2ccccc2)Cc2ccc(C(=O)NCc3ccccc3)cc2)cc1 |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 00000010 00804808 21080108 41b10600 00081000 00000000 06000001 02001000 00000100 00001840 00302000 60008000 80008802 00000001 81200401 00000008 00002000 02100000 00400800 00026000 80000000 08028600 00000000 0840000c 02000000 c0000004 40800000 8000008c 00000700 20060001 80040000 00010360 |