On Target GRM3_HUMAN 0.32051283/CHEMBL2112634
For the given ligand Aspirin, we have found in our database that, being scored 0.32051283, the most similar ligand is CHEMBL2112634. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL2112634 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | NC(CCc1cccc(C(=O)O)c1)(C(=O)O)[C@H]1C[C@@H]1C(=O)O |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 00030000 01000a00 00000102 00010600 00180001 00004000 00000000 00000000 00000900 000a0ac0 28100000 4001b000 04008038 03a00000 00000000 08080008 00000000 02000000 00402000 40000001 00000100 18020a20 03000000 00400014 00000000 80000000 00000000 00000000 00000002 0006000a c0020000 00400400 |