On Target AGTR2_HUMAN 0.23300971/CHEMBL376286
For the given ligand Aspirin, we have found in our database that, being scored 0.23300971, the most similar ligand is CHEMBL376286. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL376286 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | CC[C@@H](C)[C@H](NC(=O)c1cccc(Cn2ccnc2)c1)C(=O)O |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 0001800a 01805a00 00100100 00010600 000810c1 00000000 10000000 22001000 00000100 00000cc0 00208008 4000b000 06009802 00000000 00000480 080c000c 10000000 02000000 00400800 00000201 80000000 18068e00 23000040 8140001c 00000000 c0000000 08000000 90000000 04000100 00460009 e00c4000 00000600 |