On Target BKRB2_HUMAN 0.2638889/CHEMBL121565
For the given ligand Aspirin, we have found in our database that, being scored 0.2638889, the most similar ligand is CHEMBL121565. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL121565 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | CCCCC[P+](CCCCC)(CCCCC)Cc1ccc(C(=O)c2ccc(C[P+](CCCCC)(CCCCC)CCCCC)cc2)cc1.[Cl-].[Cl-] |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 00000000 01000a00 00000100 40010200 00000000 00000000 00000000 25000000 00000500 00080840 08000001 40108800 00008200 00000000 02010000 00000000 02001008 02000000 00004000 00000201 00000000 08020200 00000000 20400014 00000000 a0010002 00002000 40000000 00000280 00020302 90040000 0002c400 |