On Target HRH1_HUMAN 0.36619717/CHEMBL570033
For the given ligand Aspirin, we have found in our database that, being scored 0.36619717, the most similar ligand is CHEMBL570033. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL570033 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1O | O=C(O)c1ccc(CCCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
|
|
|
|
|
|
| 00000000 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000000 40008000 00008002 00000000 00000000 00082008 00000000 02000000 00000000 00020000 00000000 08020a20 00000000 00400004 00000000 80000000 00000000 00000000 00000000 00020000 c0000000 00000000 | 00000000 01000800 00100102 40050600 00100000 00004000 00000000 21000000 00100900 000808c0 08300000 50018800 00008002 00200000 00000000 00080008 00000000 02000000 00400000 00000201 00000100 18020a20 01000000 00500014 00000000 a0000000 00000000 50000000 00000080 00060002 c0000000 00002e00 |