On Target V1AR_HUMAN 0.29069766/CHEMBL1807264
For the given ligand test1, we have found in our database that, being scored 0.29069766, the most similar ligand is CHEMBL1807264. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1807264 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | O=C(Cc1ccc(Cl)cc1)N[C@H](Cc1ccc(Cl)cc1)C(=O)NCCCO |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00008000 00003200 00100100 04010600 00000000 00000000 00000000 2000000c 00000880 000808c0 08300000 4000b800 07008026 00002000 c0000000 000c0008 00000000 02000000 00800008 00000201 00000100 38300700 01000081 83400018 00002801 80000000 00040000 10000000 0c000000 0006000b 20006000 00022600 |