On Target AA2BR_HUMAN 0.22916667/CHEMBL67949
For the given ligand test1, we have found in our database that, being scored 0.22916667, the most similar ligand is CHEMBL67949. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL67949 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | O=c1[nH]c2[nH]cnc2c(=O)n1CCc1ccccc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 0000002a 00801a00 00080100 02010600 00080040 0000c000 00008000 00000000 06500100 800808e0 0c00800c 40018000 00009000 00c00000 00280080 000c000c 00000000 02008000 00400000 00000000 80000100 18000050 21800041 81700014 02040000 c0200000 60000000 00040000 04004000 0046000a c0080000 00000680 |