On Target ADRB2_HUMAN 0.41935483/CHEMBL566992
For the given ligand test1, we have found in our database that, being scored 0.41935483, the most similar ligand is CHEMBL566992. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL566992 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | CCc1ccc(CC(C)(C)NCC(O)c2ccc(O)c(CO)c2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00000000 00000008 20100100 00010600 00001081 00004000 02000000 00000800 00000980 00080840 a8300000 40008800 00000002 00000000 00080000 00082008 10000000 02000000 00000000 40020201 00000100 18200020 02000000 81400010 00000000 80000000 00520000 00000000 04000000 00060002 40000000 00002600 |