On Target CCR4_HUMAN 0.21176471/CHEMBL1623307
For the given ligand test1, we have found in our database that, being scored 0.21176471, the most similar ligand is CHEMBL1623307. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1623307 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | CC(C)(CO)NCc1cc(Br)ccc1OCc1ccccc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 04004008 20008008 20000108 00010600 00001080 00004100 02000000 02001400 40000100 00100840 08200000 c0008000 00800812 00010000 01000501 02082008 10000000 02008000 00000000 00020000 00000040 08008020 03008000 00c01010 00004000 c0002000 00420000 80000000 00000300 00060000 44040008 08000200 |