On Target NPSR1_HUMAN 0.25274727/CHEMBL3086828
For the given ligand test1, we have found in our database that, being scored 0.25274727, the most similar ligand is CHEMBL3086828. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3086828 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | O=C1c2ccccc2C(=O)C1(c1ccccc1)N1CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00000000 01000800 00100102 04010600 00000020 00008000 00000000 02001000 00000980 00090840 08300000 4000b000 07008802 00203001 40000400 00020000 00000200 02000000 00100008 00000201 00c00100 38328240 00404021 83400014 00000800 c0000001 00000000 80000000 0c000100 00060002 80046000 00000700 |