On Target DRD2_HUMAN 0.47368422/CHEMBL93101
For the given ligand test1, we have found in our database that, being scored 0.47368422, the most similar ligand is CHEMBL93101. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL93101 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | CCCN1CCC[C@@H](c2cccc(CO)c2)C1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00000000 01000000 00100102 00010600 00001001 00004000 00000000 20000000 00100980 000808c0 28300000 50018000 00000002 00200000 00000000 00080008 00000000 02000000 00000000 40000201 00000100 18200020 01000000 81500010 00000000 80000000 00000000 10000000 04000000 00060002 40000000 00002600 |