On Target HRH3_HUMAN 0.46938777/CHEMBL272140
For the given ligand test1, we have found in our database that, being scored 0.46938777, the most similar ligand is CHEMBL272140. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL272140 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | Cc1cc(C)c(CCN2CCCC2)c(C)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00000000 00000000 00100100 00010600 00000021 00000010 00000000 20000000 00000180 000808c0 08200000 40008800 00000002 00200000 00000000 00000008 00000200 02000000 00000000 00000201 00000000 18200000 00004000 81400010 00000000 80000000 00000000 10000000 04000000 00060002 00000000 00002600 |