On Target CXCR3_HUMAN 0.29787233/CHEMBL3898146
For the given ligand test1, we have found in our database that, being scored 0.29787233, the most similar ligand is CHEMBL3898146. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3898146 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | Cc1cc(CN(CC(C)C)C(CC(=O)O)c2ccc(Cl)cc2)ccc1CCCN1C(=O)CCC1=O |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00028000 00001200 00100100 00010600 00000001 00000010 10000000 22001000 00000900 000808c0 08300000 40009800 8e008866 00200000 00000400 020c0008 00002000 02000000 00c00018 00000201 00020100 18048f00 010040c0 00400018 00003801 c0000001 08040000 90000000 00000102 0006000b 20040000 00822600 |