On Target NPBW1_HUMAN 0.19014084/CHEMBL2001338
For the given ligand test1, we have found in our database that, being scored 0.19014084, the most similar ligand is CHEMBL2001338. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL2001338 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | N#CC(Cc1ccccc1)c1c(Cl)cnn(Cc2cccc3ccccc23)c1=O |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00010006 52002608 20008180 00810618 00080047 40108000 0004a000 00001008 06100800 800808c0 08102008 7001a880 0e00982a 08e00000 00040000 080d240c 08400008 82004000 00200010 00220001 00000500 1c118118 21800c81 8b700014 04107000 80000600 00128000 10040000 04080000 0006000a 04040000 008205a0 |