On Target 5HT1E_HUMAN 0.26136363/CHEMBL4092027
For the given ligand test1, we have found in our database that, being scored 0.26136363, the most similar ligand is CHEMBL4092027. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL4092027 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | Cc1cc(CCNCc2ccc3c(C)cc(N)nc3c2)ccc1C#N |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00000002 00000800 00104100 00010600 00041025 00000000 00000000 02001000 00000180 00880840 08200004 40808800 80000802 00600000 00000440 000c000c 00400008 02000000 00a00000 00200200 40000000 1c208008 20800c80 81600010 00044000 c0000000 000000c0 80000000 04000108 00060402 20048000 00000620 |